C17H32O2 — CID 157482006
2,2-dimethylpentan-3-one;2,2,4,5-tetramethylhex-4-en-3-one (PubChem CID 157482006) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 2,2-dimethylpentan-3-one;2,2,4,5-tetramethylhex-4-en-3-one.
| Compound Name | 2,2-dimethylpentan-3-one;2,2,4,5-tetramethylhex-4-en-3-one |
|---|---|
| PubChem CID | 157482006 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 2,2-dimethylpentan-3-one;2,2,4,5-tetramethylhex-4-en-3-one |
| SMILES | CC(C)=C(C)C(=O)C(C)(C)C.CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H18O.C7H14O/c1-7(2)8(3)9(11)10(4,5)6;1-5-6(8)7(2,3)4/h1-6H3;5H2,1-4H3 |
| InChIKey | BWGOOSKGMNVAEF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|