C19H32Br2N2O2 — CID 157357719
2,4-bis(bromomethyl)-1,3,5-trimethylbenzene;tert-butyl N-(3-aminopropyl)carbamate (PubChem CID 157357719) has the molecular formula C19H32Br2N2O2 and a molecular weight of 480.29 g/mol. Its IUPAC name is 2,4-bis(bromomethyl)-1,3,5-trimethylbenzene;tert-butyl N-(3-aminopropyl)carbamate.
| Compound Name | 2,4-bis(bromomethyl)-1,3,5-trimethylbenzene;tert-butyl N-(3-aminopropyl)carbamate |
|---|---|
| PubChem CID | 157357719 |
| Molecular Formula | C19H32Br2N2O2 |
| Molecular Weight | 480.29 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2,4-bis(bromomethyl)-1,3,5-trimethylbenzene;tert-butyl N-(3-aminopropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN.Cc1cc(C)c(CBr)c(C)c1CBr |
| InChI | InChI=1S/C11H14Br2.C8H18N2O2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12;1-8(2,3)12-7(11)10-6-4-5-9/h4H,5-6H2,1-3H3;4-6,9H2,1-3H3,(H,10,11) |
| InChIKey | BIHAWGLKFCOUAA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.29 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|