C15H15F13N2S3 — CID 157362272
1-(2,2-dimethylpropyl)-4,5-bis(sulfanyl)-3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)imidazole-2-thione (PubChem CID 157362272) has the molecular formula C15H15F13N2S3 and a molecular weight of 566.47 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-4,5-bis(sulfanyl)-3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)imidazole-2-thione.
| Compound Name | 1-(2,2-dimethylpropyl)-4,5-bis(sulfanyl)-3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)imidazole-2-thione |
|---|---|
| PubChem CID | 157362272 |
| Molecular Formula | C15H15F13N2S3 |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 566.02 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-4,5-bis(sulfanyl)-3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)imidazole-2-thione |
| SMILES | CC(C)(C)Cn1c(S)c(S)n(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1=S |
| InChI | InChI=1S/C15H15F13N2S3/c1-9(2,3)4-29-6(31)7(32)30(8(29)33)5-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h31-32H,4-5H2,1-3H3 |
| InChIKey | HCTLUJBBKDGRKD-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|