C30H16F36N4PoS6 — CID 149369515
6,6',8,8'-tetrakis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3,3'-spirobi[2,4-dithia-3λ4-polona-6,8-diazabicyclo[3.3.0]oct-1(5)-ene]-7,7'-dithione (PubChem CID 149369515) has the molecular formula C30H16F36N4PoS6 and a molecular weight of 1517.82 g/mol. Its IUPAC name is 6,6',8,8'-tetrakis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3,3'-spirobi[2,4-dithia-3λ4-polona-6,8-diazabicyclo[3.3.0]oct-1(5)-ene]-7,7'-dithione.
| Compound Name | 6,6',8,8'-tetrakis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3,3'-spirobi[2,4-dithia-3λ4-polona-6,8-diazabicyclo[3.3.0]oct-1(5)-ene]-7,7'-dithione |
|---|---|
| PubChem CID | 149369515 |
| Molecular Formula | C30H16F36N4PoS6 |
| Molecular Weight | 1517.82 g/mol |
| Exact Mass | 1516.89 |
| IUPAC Name | 6,6',8,8'-tetrakis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3,3'-spirobi[2,4-dithia-3λ4-polona-6,8-diazabicyclo[3.3.0]oct-1(5)-ene]-7,7'-dithione |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCn1c2c(n(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1=S)S[Po]1(S2)Sc2c(n(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(=S)n2CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S1 |
| InChI | InChI=1S/2C15H10F18N2S3.Po/c2*16-8(17,10(20,21)12(24,25)14(28,29)30)1-3-34-5(36)6(37)35(7(34)38)4-2-9(18,19)11(22,23)13(26,27)15(31,32)33;/h2*36-37H,1-4H2;/q;;+4/p-4 |
| InChIKey | YJNIWZWAVZWZKU-UHFFFAOYSA-J |
| XLogP | 17.32 |
| TPSA | 19.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1517.82 |
| LogP ≤ 5 | 17.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|