C26H18F26N4S2 — CID 139050554
1-ethenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazole-2-thione (PubChem CID 139050554) has the molecular formula C26H18F26N4S2 and a molecular weight of 944.54 g/mol. Its IUPAC name is 1-ethenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazole-2-thione.
| Compound Name | 1-ethenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazole-2-thione |
|---|---|
| PubChem CID | 139050554 |
| Molecular Formula | C26H18F26N4S2 |
| Molecular Weight | 944.54 g/mol |
| Exact Mass | 944.06 |
| IUPAC Name | 1-ethenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazole-2-thione |
| SMILES | C=Cn1ccn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1=S.C=Cn1ccn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1=S |
| InChI | InChI=1S/2C13H9F13N2S/c2*1-2-27-5-6-28(7(27)29)4-3-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h2*2,5-6H,1,3-4H2 |
| InChIKey | QRZQCCMEWQSQNY-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 19.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.54 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|