C17H10F22N2S3 — CID 158195347
4,5-bis(sulfanyl)-1,3-bis(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)imidazole-2-thione (PubChem CID 158195347) has the molecular formula C17H10F22N2S3 and a molecular weight of 756.44 g/mol. Its IUPAC name is 4,5-bis(sulfanyl)-1,3-bis(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)imidazole-2-thione.
| Compound Name | 4,5-bis(sulfanyl)-1,3-bis(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)imidazole-2-thione |
|---|---|
| PubChem CID | 158195347 |
| Molecular Formula | C17H10F22N2S3 |
| Molecular Weight | 756.44 g/mol |
| Exact Mass | 755.97 |
| IUPAC Name | 4,5-bis(sulfanyl)-1,3-bis(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)imidazole-2-thione |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCn1c(S)c(S)n(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1=S |
| InChI | InChI=1S/C17H10F22N2S3/c18-8(19,10(22,23)12(26,27)14(30,31)16(34,35)36)1-3-40-5(42)6(43)41(7(40)44)4-2-9(20,21)11(24,25)13(28,29)15(32,33)17(37,38)39/h42-43H,1-4H2 |
| InChIKey | LJRDOVRAFZYFKK-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 9.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.44 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|