C20H13F25N2S3 — CID 158195350
1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorononyl)-4,5-bis(sulfanyl)-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazole-2-thione (PubChem CID 158195350) has the molecular formula C20H13F25N2S3 and a molecular weight of 852.49 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorononyl)-4,5-bis(sulfanyl)-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazole-2-thione.
| Compound Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorononyl)-4,5-bis(sulfanyl)-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazole-2-thione |
|---|---|
| PubChem CID | 158195350 |
| Molecular Formula | C20H13F25N2S3 |
| Molecular Weight | 852.49 g/mol |
| Exact Mass | 851.98 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorononyl)-4,5-bis(sulfanyl)-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazole-2-thione |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCn1c(S)c(S)n(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1=S |
| InChI | InChI=1S/C20H13F25N2S3/c1-9(21,22)12(27,28)15(33,34)16(35,36)13(29,30)10(23,24)2-4-46-6(48)7(49)47(8(46)50)5-3-11(25,26)14(31,32)17(37,38)18(39,40)19(41,42)20(43,44)45/h48-49H,2-5H2,1H3 |
| InChIKey | KIULBRCYUASPSM-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 9.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.49 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|