C54H38BBr2ClN6O2 — CID 157366748
(3-bromophenyl)boronic acid;2-(3-bromophenyl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine;2-chloro-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 157366748) has the molecular formula C54H38BBr2ClN6O2 and a molecular weight of 1009.01 g/mol. Its IUPAC name is (3-bromophenyl)boronic acid;2-(3-bromophenyl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine;2-chloro-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | (3-bromophenyl)boronic acid;2-(3-bromophenyl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine;2-chloro-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 157366748 |
| Molecular Formula | C54H38BBr2ClN6O2 |
| Molecular Weight | 1009.01 g/mol |
| Exact Mass | 1006.12 |
| IUPAC Name | (3-bromophenyl)boronic acid;2-(3-bromophenyl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine;2-chloro-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Brc1cccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccccc4)c3)n2)c1.Clc1nc(-c2ccccc2)nc(-c2cccc(-c3ccccc3)c2)n1.OB(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C27H18BrN3.C21H14ClN3.C6H6BBrO2/c28-24-16-8-15-23(18-24)27-30-25(20-11-5-2-6-12-20)29-26(31-27)22-14-7-13-21(17-22)19-9-3-1-4-10-19;22-21-24-19(16-10-5-2-6-11-16)23-20(25-21)18-13-7-12-17(14-18)15-8-3-1-4-9-15;8-6-3-1-2-5(4-6)7(9)10/h1-18H;1-14H;1-4,9-10H |
| InChIKey | BJGVBQHBRVTWBY-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.01 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|