C15H18N4 — CID 157380124
N-cyclopentyl-7-cyclopropylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 157380124) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-cyclopentyl-7-cyclopropylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-cyclopentyl-7-cyclopropylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 157380124 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-cyclopentyl-7-cyclopropylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | c1nc(NC2CCCC2)c2ncc(C3CC3)cc2n1 |
| InChI | InChI=1S/C15H18N4/c1-2-4-12(3-1)19-15-14-13(17-9-18-15)7-11(8-16-14)10-5-6-10/h7-10,12H,1-6H2,(H,17,18,19) |
| InChIKey | QXJSAVRJRISNLF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |