C18H24N4O9P2 — CID 167108706
[[(1R,3S,4S,5S)-3-[4-(cyclopentylamino)pyrido[3,2-d]pyrimidin-7-yl]-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 167108706) has the molecular formula C18H24N4O9P2 and a molecular weight of 502.36 g/mol. Its IUPAC name is [[(1R,3S,4S,5S)-3-[4-(cyclopentylamino)pyrido[3,2-d]pyrimidin-7-yl]-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(1R,3S,4S,5S)-3-[4-(cyclopentylamino)pyrido[3,2-d]pyrimidin-7-yl]-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 167108706 |
| Molecular Formula | C18H24N4O9P2 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | [[(1R,3S,4S,5S)-3-[4-(cyclopentylamino)pyrido[3,2-d]pyrimidin-7-yl]-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC1[C@H]2O[C@@H](c3cnc4c(NC5CCCC5)ncnc4c3)[C@H](O)[C@@]12O |
| InChI | InChI=1S/C18H24N4O9P2/c23-14-13(30-15-16(18(14,15)24)31-33(28,29)8-32(25,26)27)9-5-11-12(19-6-9)17(21-7-20-11)22-10-3-1-2-4-10/h5-7,10,13-16,23-24H,1-4,8H2,(H,28,29)(H,20,21,22)(H2,25,26,27)/t13-,14-,15+,16?,18-/m0/s1 |
| InChIKey | JUWUJKWLZPFQNB-ZOWQXGHRSA-N |
| XLogP | 0.63 |
| TPSA | 204.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|