C18H24ClN3O10P2 — CID 155224366
[[(2R,3S,4R,5S)-5-[2-chloro-4-[[(3S)-oxolan-3-yl]amino]quinazolin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155224366) has the molecular formula C18H24ClN3O10P2 and a molecular weight of 539.80 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[2-chloro-4-[[(3S)-oxolan-3-yl]amino]quinazolin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5S)-5-[2-chloro-4-[[(3S)-oxolan-3-yl]amino]quinazolin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155224366 |
| Molecular Formula | C18H24ClN3O10P2 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[2-chloro-4-[[(3S)-oxolan-3-yl]amino]quinazolin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](c2ccc3c(N[C@H]4CCOC4)nc(Cl)nc3c2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H24ClN3O10P2/c19-18-21-12-5-9(1-2-11(12)17(22-18)20-10-3-4-30-6-10)16-15(24)14(23)13(32-16)7-31-34(28,29)8-33(25,26)27/h1-2,5,10,13-16,23-24H,3-4,6-8H2,(H,28,29)(H,20,21,22)(H2,25,26,27)/t10-,13+,14+,15+,16-/m0/s1 |
| InChIKey | SJSRTSKTQTWFGA-SHSWAGTRSA-N |
| XLogP | 0.98 |
| TPSA | 200.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|