C36H35N5O4S — CID 157383988
(3aS,7aR)-4-carbazol-9-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;cis-(1S,2S)-2-azido-6-carbazol-9-ylcyclohexan-1-ol (PubChem CID 157383988) has the molecular formula C36H35N5O4S and a molecular weight of 633.77 g/mol. Its IUPAC name is (3aS,7aR)-4-carbazol-9-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;cis-(1S,2S)-2-azido-6-carbazol-9-ylcyclohexan-1-ol.
| Compound Name | (3aS,7aR)-4-carbazol-9-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;cis-(1S,2S)-2-azido-6-carbazol-9-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 157383988 |
| Molecular Formula | C36H35N5O4S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | (3aS,7aR)-4-carbazol-9-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;cis-(1S,2S)-2-azido-6-carbazol-9-ylcyclohexan-1-ol |
| SMILES | O=S1O[C@@H]2CCCC(n3c4ccccc4c4ccccc43)[C@@H]2O1.[N-]=[N+]=N[C@H]1CCCC(n2c3ccccc3c3ccccc32)[C@@H]1O |
| InChI | InChI=1S/C18H18N4O.C18H17NO3S/c19-21-20-14-8-5-11-17(18(14)23)22-15-9-3-1-6-12(15)13-7-2-4-10-16(13)22;20-23-21-17-11-5-10-16(18(17)22-23)19-14-8-3-1-6-12(14)13-7-2-4-9-15(13)19/h1-4,6-7,9-10,14,17-18,23H,5,8,11H2;1-4,6-9,16-18H,5,10-11H2/t14-,17?,18+;16?,17-,18+,23?/m01/s1 |
| InChIKey | BLFDLWDYIOWZOT-PQRQABDVSA-N |
| XLogP | 8.44 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|