C10H17N5 — CID 157387945
1-(cyclopenta-1,4-dien-1-ylmethyl)-3-(diaminomethylidene)-1,2-dimethylguanidine (PubChem CID 157387945) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-(cyclopenta-1,4-dien-1-ylmethyl)-3-(diaminomethylidene)-1,2-dimethylguanidine.
| Compound Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-3-(diaminomethylidene)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 157387945 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-3-(diaminomethylidene)-1,2-dimethylguanidine |
| SMILES | C/N=C(/N=C(N)N)N(C)CC1=CCC=C1 |
| InChI | InChI=1S/C10H17N5/c1-13-10(14-9(11)12)15(2)7-8-5-3-4-6-8/h3,5-6H,4,7H2,1-2H3,(H4,11,12,13,14) |
| InChIKey | YPZOBIDZLYDUPN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|