C26H26N4O2S — CID 157393893
3-amino-N-cyclohexa-1,3-dien-1-yl-N-[(Z)-4-hydroxybut-2-enyl]-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxamide;prop-1-yne (PubChem CID 157393893) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 3-amino-N-cyclohexa-1,3-dien-1-yl-N-[(Z)-4-hydroxybut-2-enyl]-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxamide;prop-1-yne.
| Compound Name | 3-amino-N-cyclohexa-1,3-dien-1-yl-N-[(Z)-4-hydroxybut-2-enyl]-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxamide;prop-1-yne |
|---|---|
| PubChem CID | 157393893 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 3-amino-N-cyclohexa-1,3-dien-1-yl-N-[(Z)-4-hydroxybut-2-enyl]-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxamide;prop-1-yne |
| SMILES | C#CC.Nc1c(C(=O)N(C/C=C\CO)C2=CC=CCC2)sc2nc(-c3cccnc3)ccc12 |
| InChI | InChI=1S/C23H22N4O2S.C3H4/c24-20-18-10-11-19(16-7-6-12-25-15-16)26-22(18)30-21(20)23(29)27(13-4-5-14-28)17-8-2-1-3-9-17;1-3-2/h1-2,4-8,10-12,15,28H,3,9,13-14,24H2;1H,2H3/b5-4-; |
| InChIKey | BMIMVMUPYPAPEA-MKWAYWHRSA-N |
| XLogP | 4.80 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|