C31H27ClN4O4 — CID 157395131
methyl N-[4-[2-[1-[5-[5-chloro-2-(1,3-oxazol-5-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-3H-pyrrol-4-yl]phenyl]carbamate (PubChem CID 157395131) has the molecular formula C31H27ClN4O4 and a molecular weight of 555.03 g/mol. Its IUPAC name is methyl N-[4-[2-[1-[5-[5-chloro-2-(1,3-oxazol-5-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-3H-pyrrol-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[2-[1-[5-[5-chloro-2-(1,3-oxazol-5-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-3H-pyrrol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 157395131 |
| Molecular Formula | C31H27ClN4O4 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | methyl N-[4-[2-[1-[5-[5-chloro-2-(1,3-oxazol-5-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-cyclopropylethyl]-3H-pyrrol-4-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(C2=CN=C(C(CC3CC3)c3ccc(-c4cc(Cl)ccc4-c4cnco4)c[n+]3[O-])C2)cc1 |
| InChI | InChI=1S/C31H27ClN4O4/c1-39-31(37)35-24-8-4-20(5-9-24)22-13-28(34-15-22)27(12-19-2-3-19)29-11-6-21(17-36(29)38)26-14-23(32)7-10-25(26)30-16-33-18-40-30/h4-11,14-19,27H,2-3,12-13H2,1H3,(H,35,37) |
| InChIKey | HBCCFVFPPHQPDY-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|