C25H39N3O7 — CID 157398002
tert-butyl (2S)-2-formylpyrrolidine-1-carboxylate;tert-butyl (2S)-2-(3H-pyrrol-2-yl)pyrrolidine-1-carboxylate;oxaldehyde (PubChem CID 157398002) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-formylpyrrolidine-1-carboxylate;tert-butyl (2S)-2-(3H-pyrrol-2-yl)pyrrolidine-1-carboxylate;oxaldehyde.
| Compound Name | tert-butyl (2S)-2-formylpyrrolidine-1-carboxylate;tert-butyl (2S)-2-(3H-pyrrol-2-yl)pyrrolidine-1-carboxylate;oxaldehyde |
|---|---|
| PubChem CID | 157398002 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | tert-butyl (2S)-2-formylpyrrolidine-1-carboxylate;tert-butyl (2S)-2-(3H-pyrrol-2-yl)pyrrolidine-1-carboxylate;oxaldehyde |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC=CC1.CC(C)(C)OC(=O)N1CCC[C@H]1C=O.O=CC=O |
| InChI | InChI=1S/C13H20N2O2.C10H17NO3.C2H2O2/c1-13(2,3)17-12(16)15-9-5-7-11(15)10-6-4-8-14-10;1-10(2,3)14-9(13)11-6-4-5-8(11)7-12;3-1-2-4/h4,8,11H,5-7,9H2,1-3H3;7-8H,4-6H2,1-3H3;1-2H/t11-;8-;/m00./s1 |
| InChIKey | BMUOLAFYQZTBAY-IMSUZSGZSA-N |
| XLogP | 3.71 |
| TPSA | 122.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|