C24H38N4O7 — CID 161363057
tert-butyl (2S)-2-formylpyrrolidine-1-carboxylate;tert-butyl (2S)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate;oxaldehyde (PubChem CID 161363057) has the molecular formula C24H38N4O7 and a molecular weight of 494.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-formylpyrrolidine-1-carboxylate;tert-butyl (2S)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate;oxaldehyde.
| Compound Name | tert-butyl (2S)-2-formylpyrrolidine-1-carboxylate;tert-butyl (2S)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate;oxaldehyde |
|---|---|
| PubChem CID | 161363057 |
| Molecular Formula | C24H38N4O7 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | tert-butyl (2S)-2-formylpyrrolidine-1-carboxylate;tert-butyl (2S)-2-(1H-imidazol-2-yl)pyrrolidine-1-carboxylate;oxaldehyde |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C=O.CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc[nH]1.O=CC=O |
| InChI | InChI=1S/C12H19N3O2.C10H17NO3.C2H2O2/c1-12(2,3)17-11(16)15-8-4-5-9(15)10-13-6-7-14-10;1-10(2,3)14-9(13)11-6-4-5-8(11)7-12;3-1-2-4/h6-7,9H,4-5,8H2,1-3H3,(H,13,14);7-8H,4-6H2,1-3H3;1-2H/t9-;8-;/m00./s1 |
| InChIKey | VPLDVPDIBAKSQT-BFLLFUATSA-N |
| XLogP | 3.45 |
| TPSA | 138.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|