C57H34Br2N6O11 — CID 157412874
3,7-dibromo-1,5-dinitronaphthalene;10-(4,8-dinitro-6-phenoxazin-10-ylnaphthalen-2-yl)phenoxazine;9H-xanthene (PubChem CID 157412874) has the molecular formula C57H34Br2N6O11 and a molecular weight of 1138.74 g/mol. Its IUPAC name is 3,7-dibromo-1,5-dinitronaphthalene;10-(4,8-dinitro-6-phenoxazin-10-ylnaphthalen-2-yl)phenoxazine;9H-xanthene.
| Compound Name | 3,7-dibromo-1,5-dinitronaphthalene;10-(4,8-dinitro-6-phenoxazin-10-ylnaphthalen-2-yl)phenoxazine;9H-xanthene |
|---|---|
| PubChem CID | 157412874 |
| Molecular Formula | C57H34Br2N6O11 |
| Molecular Weight | 1138.74 g/mol |
| Exact Mass | 1136.07 |
| IUPAC Name | 3,7-dibromo-1,5-dinitronaphthalene;10-(4,8-dinitro-6-phenoxazin-10-ylnaphthalen-2-yl)phenoxazine;9H-xanthene |
| SMILES | O=[N+]([O-])c1cc(Br)cc2c([N+](=O)[O-])cc(Br)cc12.O=[N+]([O-])c1cc(N2c3ccccc3Oc3ccccc32)cc2c([N+](=O)[O-])cc(N3c4ccccc4Oc4ccccc43)cc12.c1ccc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C34H20N4O6.C13H10O.C10H4Br2N2O4/c39-37(40)29-19-21(35-25-9-1-5-13-31(25)43-32-14-6-2-10-26(32)35)17-23-24(29)18-22(20-30(23)38(41)42)36-27-11-3-7-15-33(27)44-34-16-8-4-12-28(34)36;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;11-5-1-7-8(10(3-5)14(17)18)2-6(12)4-9(7)13(15)16/h1-20H;1-8H,9H2;1-4H |
| InChIKey | BOMKWRGEOFFGSE-UHFFFAOYSA-N |
| XLogP | 17.37 |
| TPSA | 206.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.74 |
| LogP ≤ 5 | 17.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|