C25H42N2O11 — CID 157417113
[2,5-dioxo-5-[2-[2-(2-oxobutoxy)ethoxy]ethylamino]pentyl] 2-methyl-3-oxo-3-[2-[2-(2-oxobutoxy)ethoxy]ethylamino]propanoate (PubChem CID 157417113) has the molecular formula C25H42N2O11 and a molecular weight of 546.61 g/mol. Its IUPAC name is [2,5-dioxo-5-[2-[2-(2-oxobutoxy)ethoxy]ethylamino]pentyl] 2-methyl-3-oxo-3-[2-[2-(2-oxobutoxy)ethoxy]ethylamino]propanoate.
| Compound Name | [2,5-dioxo-5-[2-[2-(2-oxobutoxy)ethoxy]ethylamino]pentyl] 2-methyl-3-oxo-3-[2-[2-(2-oxobutoxy)ethoxy]ethylamino]propanoate |
|---|---|
| PubChem CID | 157417113 |
| Molecular Formula | C25H42N2O11 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [2,5-dioxo-5-[2-[2-(2-oxobutoxy)ethoxy]ethylamino]pentyl] 2-methyl-3-oxo-3-[2-[2-(2-oxobutoxy)ethoxy]ethylamino]propanoate |
| SMILES | CCC(=O)COCCOCCNC(=O)CCC(=O)COC(=O)C(C)C(=O)NCCOCCOCC(=O)CC |
| InChI | InChI=1S/C25H42N2O11/c1-4-20(28)16-36-14-12-34-10-8-26-23(31)7-6-22(30)18-38-25(33)19(3)24(32)27-9-11-35-13-15-37-17-21(29)5-2/h19H,4-18H2,1-3H3,(H,26,31)(H,27,32) |
| InChIKey | ZKIJUXIQKATCIZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|