C20H42N2O4 — CID 157420851
tert-butyl 4-hydroxy-5-methylazepane-1-carboxylate;methane;5-methylazepan-4-ol (PubChem CID 157420851) has the molecular formula C20H42N2O4 and a molecular weight of 374.57 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-5-methylazepane-1-carboxylate;methane;5-methylazepan-4-ol.
| Compound Name | tert-butyl 4-hydroxy-5-methylazepane-1-carboxylate;methane;5-methylazepan-4-ol |
|---|---|
| PubChem CID | 157420851 |
| Molecular Formula | C20H42N2O4 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | tert-butyl 4-hydroxy-5-methylazepane-1-carboxylate;methane;5-methylazepan-4-ol |
| SMILES | C.CC1CCN(C(=O)OC(C)(C)C)CCC1O.CC1CCNCCC1O |
| InChI | InChI=1S/C12H23NO3.C7H15NO.CH4/c1-9-5-7-13(8-6-10(9)14)11(15)16-12(2,3)4;1-6-2-4-8-5-3-7(6)9;/h9-10,14H,5-8H2,1-4H3;6-9H,2-5H2,1H3;1H4 |
| InChIKey | BPJQICPJGYOZLD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |