C23H22F4O3S — CID 157420887
4-[(4R,5R)-3-(2-fluorophenyl)-5-methyl-4-(2,2,2-trifluoro-1-hydroxyethyl)oxolan-3-yl]-1-phenyl-3-sulfanylidenebutan-1-one (PubChem CID 157420887) has the molecular formula C23H22F4O3S and a molecular weight of 454.49 g/mol. Its IUPAC name is 4-[(4R,5R)-3-(2-fluorophenyl)-5-methyl-4-(2,2,2-trifluoro-1-hydroxyethyl)oxolan-3-yl]-1-phenyl-3-sulfanylidenebutan-1-one.
| Compound Name | 4-[(4R,5R)-3-(2-fluorophenyl)-5-methyl-4-(2,2,2-trifluoro-1-hydroxyethyl)oxolan-3-yl]-1-phenyl-3-sulfanylidenebutan-1-one |
|---|---|
| PubChem CID | 157420887 |
| Molecular Formula | C23H22F4O3S |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 4-[(4R,5R)-3-(2-fluorophenyl)-5-methyl-4-(2,2,2-trifluoro-1-hydroxyethyl)oxolan-3-yl]-1-phenyl-3-sulfanylidenebutan-1-one |
| SMILES | C[C@H]1OCC(CC(=S)CC(=O)c2ccccc2)(c2ccccc2F)[C@@H]1C(O)C(F)(F)F |
| InChI | InChI=1S/C23H22F4O3S/c1-14-20(21(29)23(25,26)27)22(13-30-14,17-9-5-6-10-18(17)24)12-16(31)11-19(28)15-7-3-2-4-8-15/h2-10,14,20-21,29H,11-13H2,1H3/t14-,20+,21?,22?/m1/s1 |
| InChIKey | WLVHKXFVRFWPRU-UKBVYQIRSA-N |
| XLogP | 5.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|