C21H30ClN3O5 — CID 157457027
tert-butyl 5-(2-chloro-5-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 157457027) has the molecular formula C21H30ClN3O5 and a molecular weight of 439.94 g/mol. Its IUPAC name is tert-butyl 5-(2-chloro-5-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 5-(2-chloro-5-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 157457027 |
| Molecular Formula | C21H30ClN3O5 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | tert-butyl 5-(2-chloro-5-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | COc1cc(C2CN(C(=O)OC(C)(C)C)CCC23CCNCC3)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H30ClN3O5/c1-20(2,3)30-19(26)24-10-7-21(5-8-23-9-6-21)15(13-24)14-11-18(29-4)17(25(27)28)12-16(14)22/h11-12,15,23H,5-10,13H2,1-4H3 |
| InChIKey | BTMDISFLDIWIEA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|