C30H51N3O5S3 — CID 157469693
(4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(9E,12E)-octadeca-9,12-dienylidene]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 157469693) has the molecular formula C30H51N3O5S3 and a molecular weight of 629.96 g/mol. Its IUPAC name is (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(9E,12E)-octadeca-9,12-dienylidene]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(9E,12E)-octadeca-9,12-dienylidene]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 157469693 |
| Molecular Formula | C30H51N3O5S3 |
| Molecular Weight | 629.96 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(9E,12E)-octadeca-9,12-dienylidene]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC=NS(=O)(=O)c1cc2c(s1)S(=O)(=O)N(CCCOC)C[C@@H]2NCC |
| InChI | InChI=1S/C30H51N3O5S3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-32-40(34,35)29-25-27-28(31-5-2)26-33(23-21-24-38-3)41(36,37)30(27)39-29/h9-10,12-13,22,25,28,31H,4-8,11,14-21,23-24,26H2,1-3H3/b10-9+,13-12+,32-22?/t28-/m0/s1 |
| InChIKey | HNPQGFKYBPXERE-PBDUQERJSA-N |
| XLogP | 7.01 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.96 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|