C12H26O9S — CID 157469832
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioic S-acid (PubChem CID 157469832) has the molecular formula C12H26O9S and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioic S-acid.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioic S-acid |
|---|---|
| PubChem CID | 157469832 |
| Molecular Formula | C12H26O9S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioic S-acid |
| SMILES | CCC(CO)(CO)CO.O=C(S)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6S.C6H14O3/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-2-6(3-7,4-8)5-9/h2-5,7-11H,1H2,(H,12,13);7-9H,2-5H2,1H3/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | BUXCNACWOGHWHV-JJKGCWMISA-N |
| XLogP | -3.76 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|