C12H22O2 — CID 15747681
(Z)-8-methoxy-4,8-dimethylnon-3-en-2-one (PubChem CID 15747681) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (Z)-8-methoxy-4,8-dimethylnon-3-en-2-one.
| Compound Name | (Z)-8-methoxy-4,8-dimethylnon-3-en-2-one |
|---|---|
| PubChem CID | 15747681 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (Z)-8-methoxy-4,8-dimethylnon-3-en-2-one |
| SMILES | COC(C)(C)CCC/C(C)=C\C(C)=O |
| InChI | InChI=1S/C12H22O2/c1-10(9-11(2)13)7-6-8-12(3,4)14-5/h9H,6-8H2,1-5H3/b10-9- |
| InChIKey | WBBUZRAXPYSOGI-KTKRTIGZSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|