C19H39BrF12O7S — CID 157487875
2-(3-bromopropoxy)propanoic acid;methane;2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropoxy)propanoyl fluoride (PubChem CID 157487875) has the molecular formula C19H39BrF12O7S and a molecular weight of 719.46 g/mol. Its IUPAC name is 2-(3-bromopropoxy)propanoic acid;methane;2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropoxy)propanoyl fluoride.
| Compound Name | 2-(3-bromopropoxy)propanoic acid;methane;2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropoxy)propanoyl fluoride |
|---|---|
| PubChem CID | 157487875 |
| Molecular Formula | C19H39BrF12O7S |
| Molecular Weight | 719.46 g/mol |
| Exact Mass | 718.14 |
| IUPAC Name | 2-(3-bromopropoxy)propanoic acid;methane;2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropoxy)propanoyl fluoride |
| SMILES | C.C.C.C.C.C.C.CC(OCCCBr)C(=O)O.O=C(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)F)C(F)(F)F |
| InChI | InChI=1S/C6H11BrO3.C6F12O4S.7CH4/c1-5(6(8)9)10-4-2-3-7;7-1(19)2(8,4(11,12)13)22-5(14,15)3(9,10)6(16,17)23(18,20)21;;;;;;;/h5H,2-4H2,1H3,(H,8,9);;7*1H4 |
| InChIKey | BWXUFBIXMLTBDM-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.46 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|