C18H20N2O5 — CID 157499706
dimethylcarbamic acid;(2,6-dimethyl-4-nitrophenyl)-phenylmethanone (PubChem CID 157499706) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is dimethylcarbamic acid;(2,6-dimethyl-4-nitrophenyl)-phenylmethanone.
| Compound Name | dimethylcarbamic acid;(2,6-dimethyl-4-nitrophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 157499706 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | dimethylcarbamic acid;(2,6-dimethyl-4-nitrophenyl)-phenylmethanone |
| SMILES | CN(C)C(=O)O.Cc1cc([N+](=O)[O-])cc(C)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13NO3.C3H7NO2/c1-10-8-13(16(18)19)9-11(2)14(10)15(17)12-6-4-3-5-7-12;1-4(2)3(5)6/h3-9H,1-2H3;1-2H3,(H,5,6) |
| InChIKey | BYGLXFSYDJWZCR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|