C19H22N2O4 — CID 174903239
butanamide;(2,6-dimethyl-4-nitrophenyl)-phenylmethanone (PubChem CID 174903239) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is butanamide;(2,6-dimethyl-4-nitrophenyl)-phenylmethanone.
| Compound Name | butanamide;(2,6-dimethyl-4-nitrophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 174903239 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | butanamide;(2,6-dimethyl-4-nitrophenyl)-phenylmethanone |
| SMILES | CCCC(N)=O.Cc1cc([N+](=O)[O-])cc(C)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13NO3.C4H9NO/c1-10-8-13(16(18)19)9-11(2)14(10)15(17)12-6-4-3-5-7-12;1-2-3-4(5)6/h3-9H,1-2H3;2-3H2,1H3,(H2,5,6) |
| InChIKey | WKVZXKGKODZMLA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|