About bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+)
bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+) (PubChem CID 15757081) has the molecular formula C14H18CoO6
and a molecular weight of 341.23 g/mol. Its IUPAC name is bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+).
Molecular Properties
| Compound Name | bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+) |
| PubChem CID | 15757081 |
| Molecular Formula | C14H18CoO6 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+) |
| SMILES | CC(=O)C(C(C)=O)=C(C)[O-].CC(=O)C(C(C)=O)=C(C)[O-].[Co+2] |
| InChI | InChI=1S/2C7H10O3.Co/c2*1-4(8)7(5(2)9)6(3)10;/h2*8H,1-3H3;/q;;+2/p-2 |
| InChIKey | LEMPHKTXGQNGAM-UHFFFAOYSA-L |
| XLogP | -0.41 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+)?
The IUPAC name of bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+) (CID 15757081) is bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+).
What is the SMILES notation for bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+)?
The canonical SMILES for bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+) is CC(=O)C(C(C)=O)=C(C)[O-].CC(=O)C(C(C)=O)=C(C)[O-].[Co+2].
What is the InChIKey of bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+)?
The InChIKey is LEMPHKTXGQNGAM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H10O3.Co/c2*1-4(8)7(5(2)9)6(3)10;/h2*8H,1-3H3;/q;;+2/p-2.
What are the key properties of bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+)?
bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+) has a molecular weight of 341.23 g/mol, XLogP of -0.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-acetyl-4-oxopent-2-en-2-olate);cobalt(2+) is sourced from PubChem (CID 15757081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).