C16H24Si — CID 15758539
trimethyl-[2-[7-(2-methylprop-1-enyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl]silane (PubChem CID 15758539) has the molecular formula C16H24Si and a molecular weight of 244.45 g/mol. Its IUPAC name is trimethyl-[2-[7-(2-methylprop-1-enyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[7-(2-methylprop-1-enyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl]silane |
|---|---|
| PubChem CID | 15758539 |
| Molecular Formula | C16H24Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | trimethyl-[2-[7-(2-methylprop-1-enyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl]silane |
| SMILES | CC(C)=CC12C3CCCC1C32C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H24Si/c1-12(2)11-16-13-7-6-8-14(16)15(13,16)9-10-17(3,4)5/h11,13-14H,6-8H2,1-5H3 |
| InChIKey | GZLMAFLYXRSYMU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|