C10H12Cl3N5O — CID 158010113
5-chloro-1H-pyrazol-4-amine;1-(5-chloro-1H-pyrazol-4-yl)but-3-en-2-one;hydrochloride (PubChem CID 158010113) has the molecular formula C10H12Cl3N5O and a molecular weight of 324.60 g/mol. Its IUPAC name is 5-chloro-1H-pyrazol-4-amine;1-(5-chloro-1H-pyrazol-4-yl)but-3-en-2-one;hydrochloride.
| Compound Name | 5-chloro-1H-pyrazol-4-amine;1-(5-chloro-1H-pyrazol-4-yl)but-3-en-2-one;hydrochloride |
|---|---|
| PubChem CID | 158010113 |
| Molecular Formula | C10H12Cl3N5O |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 5-chloro-1H-pyrazol-4-amine;1-(5-chloro-1H-pyrazol-4-yl)but-3-en-2-one;hydrochloride |
| SMILES | C=CC(=O)Cc1cn[nH]c1Cl.Cl.Nc1cn[nH]c1Cl |
| InChI | InChI=1S/C7H7ClN2O.C3H4ClN3.ClH/c1-2-6(11)3-5-4-9-10-7(5)8;4-3-2(5)1-6-7-3;/h2,4H,1,3H2,(H,9,10);1H,5H2,(H,6,7);1H |
| InChIKey | DWMAABCACHBPRW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|