C11H23NO3 — CID 158011849
N-(2,5-dioxohexyl)acetamide;ethane;methane (PubChem CID 158011849) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(2,5-dioxohexyl)acetamide;ethane;methane.
| Compound Name | N-(2,5-dioxohexyl)acetamide;ethane;methane |
|---|---|
| PubChem CID | 158011849 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | N-(2,5-dioxohexyl)acetamide;ethane;methane |
| SMILES | C.CC.CC(=O)CCC(=O)CNC(C)=O |
| InChI | InChI=1S/C8H13NO3.C2H6.CH4/c1-6(10)3-4-8(12)5-9-7(2)11;1-2;/h3-5H2,1-2H3,(H,9,11);1-2H3;1H4 |
| InChIKey | FEZIIUGONBTMMC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |