C21H42N2O4 — CID 158014908
tert-butyl 2-(3-hydroxypropyl)piperidine-1-carboxylate;3-piperidin-2-ylpropan-1-ol (PubChem CID 158014908) has the molecular formula C21H42N2O4 and a molecular weight of 386.58 g/mol. Its IUPAC name is tert-butyl 2-(3-hydroxypropyl)piperidine-1-carboxylate;3-piperidin-2-ylpropan-1-ol.
| Compound Name | tert-butyl 2-(3-hydroxypropyl)piperidine-1-carboxylate;3-piperidin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 158014908 |
| Molecular Formula | C21H42N2O4 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.31 |
| IUPAC Name | tert-butyl 2-(3-hydroxypropyl)piperidine-1-carboxylate;3-piperidin-2-ylpropan-1-ol |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CCCO.OCCCC1CCCCN1 |
| InChI | InChI=1S/C13H25NO3.C8H17NO/c1-13(2,3)17-12(16)14-9-5-4-7-11(14)8-6-10-15;10-7-3-5-8-4-1-2-6-9-8/h11,15H,4-10H2,1-3H3;8-10H,1-7H2 |
| InChIKey | FFIJOUAYXPOUCU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |