C28H54N2O2 — CID 158016503
2,2,6,6-tetramethyl-1-[(Z)-pent-2-enoxy]piperidine;2,2,6,6-tetramethyl-1-pent-1-en-3-yloxypiperidine (PubChem CID 158016503) has the molecular formula C28H54N2O2 and a molecular weight of 450.75 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[(Z)-pent-2-enoxy]piperidine;2,2,6,6-tetramethyl-1-pent-1-en-3-yloxypiperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[(Z)-pent-2-enoxy]piperidine;2,2,6,6-tetramethyl-1-pent-1-en-3-yloxypiperidine |
|---|---|
| PubChem CID | 158016503 |
| Molecular Formula | C28H54N2O2 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.42 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[(Z)-pent-2-enoxy]piperidine;2,2,6,6-tetramethyl-1-pent-1-en-3-yloxypiperidine |
| SMILES | C=CC(CC)ON1C(C)(C)CCCC1(C)C.CC/C=C\CON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/2C14H27NO/c1-7-12(8-2)16-15-13(3,4)10-9-11-14(15,5)6;1-6-7-8-12-16-15-13(2,3)10-9-11-14(15,4)5/h7,12H,1,8-11H2,2-6H3;7-8H,6,9-12H2,1-5H3/b;8-7- |
| InChIKey | FFNNKNVALWGQNF-UULNMNGPSA-N |
| XLogP | 7.85 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|