C42H60N4O7 — CID 158030931
1-(azetidin-3-yl)-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentan-2-one;ethyl 2-oxoacetate;ethyl 2-[3-[2-oxo-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentyl]azetidin-1-yl]acetate (PubChem CID 158030931) has the molecular formula C42H60N4O7 and a molecular weight of 732.96 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentan-2-one;ethyl 2-oxoacetate;ethyl 2-[3-[2-oxo-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentyl]azetidin-1-yl]acetate.
| Compound Name | 1-(azetidin-3-yl)-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentan-2-one;ethyl 2-oxoacetate;ethyl 2-[3-[2-oxo-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentyl]azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 158030931 |
| Molecular Formula | C42H60N4O7 |
| Molecular Weight | 732.96 g/mol |
| Exact Mass | 732.45 |
| IUPAC Name | 1-(azetidin-3-yl)-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentan-2-one;ethyl 2-oxoacetate;ethyl 2-[3-[2-oxo-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentyl]azetidin-1-yl]acetate |
| SMILES | CCOC(=O)C=O.CCOC(=O)CN1CC(CC(=O)CCCc2ccc3c(n2)CCCC3)C1.O=C(CCCc1ccc2c(n1)CCCC2)CC1CNC1 |
| InChI | InChI=1S/C21H30N2O3.C17H24N2O.C4H6O3/c1-2-26-21(25)15-23-13-16(14-23)12-19(24)8-5-7-18-11-10-17-6-3-4-9-20(17)22-18;20-16(10-13-11-18-12-13)6-3-5-15-9-8-14-4-1-2-7-17(14)19-15;1-2-7-4(6)3-5/h10-11,16H,2-9,12-15H2,1H3;8-9,13,18H,1-7,10-12H2;3H,2H2,1H3 |
| InChIKey | FHDZUEBFVWALAD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|