C17H25F2NO — CID 158440879
2-(3,3-difluoro-7-methoxyheptyl)-5,6,7,8-tetrahydroquinoline (PubChem CID 158440879) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is 2-(3,3-difluoro-7-methoxyheptyl)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-(3,3-difluoro-7-methoxyheptyl)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 158440879 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-(3,3-difluoro-7-methoxyheptyl)-5,6,7,8-tetrahydroquinoline |
| SMILES | COCCCCC(F)(F)CCc1ccc2c(n1)CCCC2 |
| InChI | InChI=1S/C17H25F2NO/c1-21-13-5-4-11-17(18,19)12-10-15-9-8-14-6-2-3-7-16(14)20-15/h8-9H,2-7,10-13H2,1H3 |
| InChIKey | MJRTZTQRVLMCKD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|