C16H25F2N3O — CID 175526978
3,3-difluoro-N-(2-methoxyethyl)-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentan-2-amine (PubChem CID 175526978) has the molecular formula C16H25F2N3O and a molecular weight of 313.39 g/mol. Its IUPAC name is 3,3-difluoro-N-(2-methoxyethyl)-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentan-2-amine.
| Compound Name | 3,3-difluoro-N-(2-methoxyethyl)-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 175526978 |
| Molecular Formula | C16H25F2N3O |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 3,3-difluoro-N-(2-methoxyethyl)-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentan-2-amine |
| SMILES | COCCNC(C)C(F)(F)CCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C16H25F2N3O/c1-12(19-10-11-22-2)16(17,18)8-7-14-6-5-13-4-3-9-20-15(13)21-14/h5-6,12,19H,3-4,7-11H2,1-2H3,(H,20,21) |
| InChIKey | FGTSSYCDIYOUJP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|