C25H44N4O4 — CID 176962002
7-(2-cyclobutylethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane;methyl 2-formamido-4-(2-methoxyethylamino)butanoate (PubChem CID 176962002) has the molecular formula C25H44N4O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is 7-(2-cyclobutylethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane;methyl 2-formamido-4-(2-methoxyethylamino)butanoate.
| Compound Name | 7-(2-cyclobutylethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane;methyl 2-formamido-4-(2-methoxyethylamino)butanoate |
|---|---|
| PubChem CID | 176962002 |
| Molecular Formula | C25H44N4O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | 7-(2-cyclobutylethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane;methyl 2-formamido-4-(2-methoxyethylamino)butanoate |
| SMILES | CC.COCCNCCC(NC=O)C(=O)OC.c1cc2c(nc1CCC1CCC1)NCCC2 |
| InChI | InChI=1S/C14H20N2.C9H18N2O4.C2H6/c1-3-11(4-1)6-8-13-9-7-12-5-2-10-15-14(12)16-13;1-14-6-5-10-4-3-8(11-7-12)9(13)15-2;1-2/h7,9,11H,1-6,8,10H2,(H,15,16);7-8,10H,3-6H2,1-2H3,(H,11,12);1-2H3 |
| InChIKey | IGPKTKAXGKXZEE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|