C32H39N3O4 — CID 158033829
2-[2-(4,4-dimethylcyclohexen-1-yl)-6-[(1R,2S,6R,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1-(5-ethynyl-1H-imidazol-2-yl)ethanone (PubChem CID 158033829) has the molecular formula C32H39N3O4 and a molecular weight of 529.68 g/mol. Its IUPAC name is 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-[(1R,2S,6R,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1-(5-ethynyl-1H-imidazol-2-yl)ethanone.
| Compound Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-[(1R,2S,6R,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1-(5-ethynyl-1H-imidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 158033829 |
| Molecular Formula | C32H39N3O4 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-6-[(1R,2S,6R,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1-(5-ethynyl-1H-imidazol-2-yl)ethanone |
| SMILES | C#Cc1cnc(C(=O)Cc2ccc(C3C[C@@]4(C)O[C@@](C)(C3)[C@@H]3OC(C)(C)O[C@@H]34)nc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C32H39N3O4/c1-8-22-18-33-28(34-22)24(36)15-20-9-10-23(35-25(20)19-11-13-29(2,3)14-12-19)21-16-31(6)26-27(32(7,17-21)39-31)38-30(4,5)37-26/h1,9-11,18,21,26-27H,12-17H2,2-7H3,(H,33,34)/t21?,26-,27+,31+,32- |
| InChIKey | KAFJPBFEVWOPAO-LUXDAEDNSA-N |
| XLogP | 5.75 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|