C42H44N6O8 — CID 158040183
methyl (2R)-4-[6-[2-(3-aminophenyl)ethyl]-1H-indazol-3-yl]-2-methyl-4-oxobutanoate;methyl (2R)-2-methyl-4-[6-[2-(3-nitrophenyl)ethyl]-1H-indazol-3-yl]-4-oxobutanoate (PubChem CID 158040183) has the molecular formula C42H44N6O8 and a molecular weight of 760.85 g/mol. Its IUPAC name is methyl (2R)-4-[6-[2-(3-aminophenyl)ethyl]-1H-indazol-3-yl]-2-methyl-4-oxobutanoate;methyl (2R)-2-methyl-4-[6-[2-(3-nitrophenyl)ethyl]-1H-indazol-3-yl]-4-oxobutanoate.
| Compound Name | methyl (2R)-4-[6-[2-(3-aminophenyl)ethyl]-1H-indazol-3-yl]-2-methyl-4-oxobutanoate;methyl (2R)-2-methyl-4-[6-[2-(3-nitrophenyl)ethyl]-1H-indazol-3-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 158040183 |
| Molecular Formula | C42H44N6O8 |
| Molecular Weight | 760.85 g/mol |
| Exact Mass | 760.32 |
| IUPAC Name | methyl (2R)-4-[6-[2-(3-aminophenyl)ethyl]-1H-indazol-3-yl]-2-methyl-4-oxobutanoate;methyl (2R)-2-methyl-4-[6-[2-(3-nitrophenyl)ethyl]-1H-indazol-3-yl]-4-oxobutanoate |
| SMILES | COC(=O)[C@H](C)CC(=O)c1n[nH]c2cc(CCc3cccc(N)c3)ccc12.COC(=O)[C@H](C)CC(=O)c1n[nH]c2cc(CCc3cccc([N+](=O)[O-])c3)ccc12 |
| InChI | InChI=1S/C21H21N3O5.C21H23N3O3/c1-13(21(26)29-2)10-19(25)20-17-9-8-15(12-18(17)22-23-20)7-6-14-4-3-5-16(11-14)24(27)28;1-13(21(26)27-2)10-19(25)20-17-9-8-15(12-18(17)23-24-20)7-6-14-4-3-5-16(22)11-14/h3-5,8-9,11-13H,6-7,10H2,1-2H3,(H,22,23);3-5,8-9,11-13H,6-7,10,22H2,1-2H3,(H,23,24)/t2*13-/m11/s1 |
| InChIKey | FIGISMIVXMPBCV-DKAPBGRZSA-N |
| XLogP | 6.95 |
| TPSA | 213.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.85 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|