C23H28N2O2 — CID 158057663
(1-butylpiperidin-4-yl) 1-methylpyrido[1,2-a]indole-10-carboxylate (PubChem CID 158057663) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (1-butylpiperidin-4-yl) 1-methylpyrido[1,2-a]indole-10-carboxylate.
| Compound Name | (1-butylpiperidin-4-yl) 1-methylpyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 158057663 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (1-butylpiperidin-4-yl) 1-methylpyrido[1,2-a]indole-10-carboxylate |
| SMILES | CCCCN1CCC(OC(=O)c2c3c(C)cccc3n3ccccc23)CC1 |
| InChI | InChI=1S/C23H28N2O2/c1-3-4-13-24-15-11-18(12-16-24)27-23(26)22-20-9-5-6-14-25(20)19-10-7-8-17(2)21(19)22/h5-10,14,18H,3-4,11-13,15-16H2,1-2H3 |
| InChIKey | FKGJNXNMDIPXSN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |