C21H29NO5S — CID 158064869
ethyl (2S,3S)-3-[[(3S)-1-methylsulfanyl-4-oxo-8-phenyloctan-3-yl]carbamoyl]oxirane-2-carboxylate (PubChem CID 158064869) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[(3S)-1-methylsulfanyl-4-oxo-8-phenyloctan-3-yl]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[(3S)-1-methylsulfanyl-4-oxo-8-phenyloctan-3-yl]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 158064869 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | ethyl (2S,3S)-3-[[(3S)-1-methylsulfanyl-4-oxo-8-phenyloctan-3-yl]carbamoyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H](CCSC)C(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C21H29NO5S/c1-3-26-21(25)19-18(27-19)20(24)22-16(13-14-28-2)17(23)12-8-7-11-15-9-5-4-6-10-15/h4-6,9-10,16,18-19H,3,7-8,11-14H2,1-2H3,(H,22,24)/t16-,18-,19-/m0/s1 |
| InChIKey | FLCGLSPWZIHTPO-WDSOQIARSA-N |
| XLogP | 2.54 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|