C39H53N3O5 — CID 158074645
1-[2-[bis[(4-methoxyphenyl)methyl]amino]-4-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methylamino]-5,6,7,8-tetrahydroquinolin-3-yl]hexan-2-one (PubChem CID 158074645) has the molecular formula C39H53N3O5 and a molecular weight of 643.87 g/mol. Its IUPAC name is 1-[2-[bis[(4-methoxyphenyl)methyl]amino]-4-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methylamino]-5,6,7,8-tetrahydroquinolin-3-yl]hexan-2-one.
| Compound Name | 1-[2-[bis[(4-methoxyphenyl)methyl]amino]-4-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methylamino]-5,6,7,8-tetrahydroquinolin-3-yl]hexan-2-one |
|---|---|
| PubChem CID | 158074645 |
| Molecular Formula | C39H53N3O5 |
| Molecular Weight | 643.87 g/mol |
| Exact Mass | 643.40 |
| IUPAC Name | 1-[2-[bis[(4-methoxyphenyl)methyl]amino]-4-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methylamino]-5,6,7,8-tetrahydroquinolin-3-yl]hexan-2-one |
| SMILES | CCCCC(=O)Cc1c(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)nc2c(c1NCC1(C)COC(C)(C)OC1)CCCC2 |
| InChI | InChI=1S/C39H53N3O5/c1-7-8-11-30(43)22-34-36(40-25-39(4)26-46-38(2,3)47-27-39)33-12-9-10-13-35(33)41-37(34)42(23-28-14-18-31(44-5)19-15-28)24-29-16-20-32(45-6)21-17-29/h14-21H,7-13,22-27H2,1-6H3,(H,40,41) |
| InChIKey | PYKUEXNQLRREES-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.87 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |