C26H34BClN6O2 — CID 158076345
2-chloro-7-(3-ethyl-1-methylpyrazol-4-yl)-1,5-naphthyridine;3-ethyl-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 158076345) has the molecular formula C26H34BClN6O2 and a molecular weight of 508.86 g/mol. Its IUPAC name is 2-chloro-7-(3-ethyl-1-methylpyrazol-4-yl)-1,5-naphthyridine;3-ethyl-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 2-chloro-7-(3-ethyl-1-methylpyrazol-4-yl)-1,5-naphthyridine;3-ethyl-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 158076345 |
| Molecular Formula | C26H34BClN6O2 |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 2-chloro-7-(3-ethyl-1-methylpyrazol-4-yl)-1,5-naphthyridine;3-ethyl-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CCc1nn(C)cc1-c1cnc2ccc(Cl)nc2c1.CCc1nn(C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H13ClN4.C12H21BN2O2/c1-3-11-10(8-19(2)18-11)9-6-13-12(16-7-9)4-5-14(15)17-13;1-7-10-9(8-15(6)14-10)13-16-11(2,3)12(4,5)17-13/h4-8H,3H2,1-2H3;8H,7H2,1-6H3 |
| InChIKey | FMKNFZNPLKYCJV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|