C12H17NS — CID 158078423
2,2-dimethylpropane;thieno[3,2-c]pyridine (PubChem CID 158078423) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 2,2-dimethylpropane;thieno[3,2-c]pyridine.
| Compound Name | 2,2-dimethylpropane;thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 158078423 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2,2-dimethylpropane;thieno[3,2-c]pyridine |
| SMILES | CC(C)(C)C.c1cc2sccc2cn1 |
| InChI | InChI=1S/C7H5NS.C5H12/c1-3-8-5-6-2-4-9-7(1)6;1-5(2,3)4/h1-5H;1-4H3 |
| InChIKey | FMQOTDABFYBLAZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |