C24H58O3Si4 — CID 158098003
1,7-bis[[butyl(dimethyl)silyl]oxy-dimethylsilyl]-4-methylheptan-4-ol (PubChem CID 158098003) has the molecular formula C24H58O3Si4 and a molecular weight of 507.07 g/mol. Its IUPAC name is 1,7-bis[[butyl(dimethyl)silyl]oxy-dimethylsilyl]-4-methylheptan-4-ol.
| Compound Name | 1,7-bis[[butyl(dimethyl)silyl]oxy-dimethylsilyl]-4-methylheptan-4-ol |
|---|---|
| PubChem CID | 158098003 |
| Molecular Formula | C24H58O3Si4 |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | 1,7-bis[[butyl(dimethyl)silyl]oxy-dimethylsilyl]-4-methylheptan-4-ol |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CCCC(C)(O)CCC[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C24H58O3Si4/c1-12-14-20-28(4,5)26-30(8,9)22-16-18-24(3,25)19-17-23-31(10,11)27-29(6,7)21-15-13-2/h25H,12-23H2,1-11H3 |
| InChIKey | PVPLVGPDPJAMMA-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|