C36H39BO4 — CID 158103270
2-[3-(3,5-diphenylphenyl)-5-methyl-2-(oxan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 158103270) has the molecular formula C36H39BO4 and a molecular weight of 546.52 g/mol. Its IUPAC name is 2-[3-(3,5-diphenylphenyl)-5-methyl-2-(oxan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(3,5-diphenylphenyl)-5-methyl-2-(oxan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158103270 |
| Molecular Formula | C36H39BO4 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 2-[3-(3,5-diphenylphenyl)-5-methyl-2-(oxan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)c(OC2CCCCO2)c(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C36H39BO4/c1-25-20-31(30-23-28(26-14-8-6-9-15-26)22-29(24-30)27-16-10-7-11-17-27)34(39-33-18-12-13-19-38-33)32(21-25)37-40-35(2,3)36(4,5)41-37/h6-11,14-17,20-24,33H,12-13,18-19H2,1-5H3 |
| InChIKey | ZCYTWBPPNJQPFB-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|