C29H48N2O4 — CID 158103571
2-[(1R,5R,6S)-6-(aminomethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid;(1R,5R)-6-ethylidenebicyclo[3.2.0]heptane;(1R,5R,6R)-6-ethyl-6-(nitromethyl)bicyclo[3.2.0]heptane (PubChem CID 158103571) has the molecular formula C29H48N2O4 and a molecular weight of 488.71 g/mol. Its IUPAC name is 2-[(1R,5R,6S)-6-(aminomethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid;(1R,5R)-6-ethylidenebicyclo[3.2.0]heptane;(1R,5R,6R)-6-ethyl-6-(nitromethyl)bicyclo[3.2.0]heptane.
| Compound Name | 2-[(1R,5R,6S)-6-(aminomethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid;(1R,5R)-6-ethylidenebicyclo[3.2.0]heptane;(1R,5R,6R)-6-ethyl-6-(nitromethyl)bicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 158103571 |
| Molecular Formula | C29H48N2O4 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.36 |
| IUPAC Name | 2-[(1R,5R,6S)-6-(aminomethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid;(1R,5R)-6-ethylidenebicyclo[3.2.0]heptane;(1R,5R,6R)-6-ethyl-6-(nitromethyl)bicyclo[3.2.0]heptane |
| SMILES | CC=C1C[C@H]2CCC[C@@H]12.CC[C@@]1(C[N+](=O)[O-])C[C@H]2CCC[C@H]21.NC[C@]1(CC(=O)O)C[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/2C10H17NO2.C9H14/c1-2-10(7-11(12)13)6-8-4-3-5-9(8)10;11-6-10(5-9(12)13)4-7-2-1-3-8(7)10;1-2-7-6-8-4-3-5-9(7)8/h8-9H,2-7H2,1H3;7-8H,1-6,11H2,(H,12,13);2,8-9H,3-6H2,1H3/t8-,9-,10+;7-,8-,10-;8-,9+/m111/s1 |
| InChIKey | FPOHWLSGAQSCSP-YALZWRSRSA-N |
| XLogP | 6.46 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|