C37H47N3O3 — CID 158115472
(Z)-4-anilinopent-3-en-2-one;(Z)-4-(2-methylanilino)pent-3-en-2-one;(Z)-4-(2,4,6-trimethylanilino)pent-3-en-2-one (PubChem CID 158115472) has the molecular formula C37H47N3O3 and a molecular weight of 581.80 g/mol. Its IUPAC name is (Z)-4-anilinopent-3-en-2-one;(Z)-4-(2-methylanilino)pent-3-en-2-one;(Z)-4-(2,4,6-trimethylanilino)pent-3-en-2-one.
| Compound Name | (Z)-4-anilinopent-3-en-2-one;(Z)-4-(2-methylanilino)pent-3-en-2-one;(Z)-4-(2,4,6-trimethylanilino)pent-3-en-2-one |
|---|---|
| PubChem CID | 158115472 |
| Molecular Formula | C37H47N3O3 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.36 |
| IUPAC Name | (Z)-4-anilinopent-3-en-2-one;(Z)-4-(2-methylanilino)pent-3-en-2-one;(Z)-4-(2,4,6-trimethylanilino)pent-3-en-2-one |
| SMILES | CC(=O)/C=C(/C)Nc1c(C)cc(C)cc1C.CC(=O)/C=C(/C)Nc1ccccc1.CC(=O)/C=C(/C)Nc1ccccc1C |
| InChI | InChI=1S/C14H19NO.C12H15NO.C11H13NO/c1-9-6-10(2)14(11(3)7-9)15-12(4)8-13(5)16;1-9-6-4-5-7-12(9)13-10(2)8-11(3)14;1-9(8-10(2)13)12-11-6-4-3-5-7-11/h6-8,15H,1-5H3;4-8,13H,1-3H3;3-8,12H,1-2H3/b12-8-;10-8-;9-8- |
| InChIKey | FQYIBXSJIRKFEG-UYVIFCRVSA-N |
| XLogP | 9.01 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|