C39H43N7O3 — CID 158118455
ethyl 1-methyl-7-(2-phenylethylamino)indole-2-carboxylate;N-(N'-methylcarbamimidoyl)-7-(2-phenylethylamino)-1H-indole-2-carboxamide (PubChem CID 158118455) has the molecular formula C39H43N7O3 and a molecular weight of 657.82 g/mol. Its IUPAC name is ethyl 1-methyl-7-(2-phenylethylamino)indole-2-carboxylate;N-(N'-methylcarbamimidoyl)-7-(2-phenylethylamino)-1H-indole-2-carboxamide.
| Compound Name | ethyl 1-methyl-7-(2-phenylethylamino)indole-2-carboxylate;N-(N'-methylcarbamimidoyl)-7-(2-phenylethylamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 158118455 |
| Molecular Formula | C39H43N7O3 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.34 |
| IUPAC Name | ethyl 1-methyl-7-(2-phenylethylamino)indole-2-carboxylate;N-(N'-methylcarbamimidoyl)-7-(2-phenylethylamino)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2cccc(NCCc3ccccc3)c2[nH]1.CCOC(=O)c1cc2cccc(NCCc3ccccc3)c2n1C |
| InChI | InChI=1S/C20H22N2O2.C19H21N5O/c1-3-24-20(23)18-14-16-10-7-11-17(19(16)22(18)2)21-13-12-15-8-5-4-6-9-15;1-21-19(20)24-18(25)16-12-14-8-5-9-15(17(14)23-16)22-11-10-13-6-3-2-4-7-13/h4-11,14,21H,3,12-13H2,1-2H3;2-9,12,22-23H,10-11H2,1H3,(H3,20,21,24,25) |
| InChIKey | FRHUWPMDJRNCLN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 138.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|